C7H12N2S4 — CID 88713722
1-[1-(dithiocarboxyamino)cyclopropyl]ethylcarbamodithioic acid (PubChem CID 88713722) has the molecular formula C7H12N2S4 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-[1-(dithiocarboxyamino)cyclopropyl]ethylcarbamodithioic acid.
| Compound Name | 1-[1-(dithiocarboxyamino)cyclopropyl]ethylcarbamodithioic acid |
|---|---|
| PubChem CID | 88713722 |
| Molecular Formula | C7H12N2S4 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 1-[1-(dithiocarboxyamino)cyclopropyl]ethylcarbamodithioic acid |
| SMILES | CC(NC(=S)S)C1(NC(=S)S)CC1 |
| InChI | InChI=1S/C7H12N2S4/c1-4(8-5(10)11)7(2-3-7)9-6(12)13/h4H,2-3H2,1H3,(H2,8,10,11)(H2,9,12,13) |
| InChIKey | CHQKCXYAJIGGLY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|