C18H18N2O2S2 — CID 8871387
ethyl (4R)-6-methyl-4-(5-phenylthiophen-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 8871387) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is ethyl (4R)-6-methyl-4-(5-phenylthiophen-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-6-methyl-4-(5-phenylthiophen-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8871387 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | ethyl (4R)-6-methyl-4-(5-phenylthiophen-2-yl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@H]1c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H18N2O2S2/c1-3-22-17(21)15-11(2)19-18(23)20-16(15)14-10-9-13(24-14)12-7-5-4-6-8-12/h4-10,16H,3H2,1-2H3,(H2,19,20,23)/t16-/m0/s1 |
| InChIKey | SYGVOVATQMGWKQ-INIZCTEOSA-N |
| XLogP | 3.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|