About 5-hydroxy-2-methylbenzenesulfonic acid;morpholine
5-hydroxy-2-methylbenzenesulfonic acid;morpholine (PubChem CID 88713946) has the molecular formula C11H17NO5S
and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-hydroxy-2-methylbenzenesulfonic acid;morpholine.
Molecular Properties
| Compound Name | 5-hydroxy-2-methylbenzenesulfonic acid;morpholine |
| PubChem CID | 88713946 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-hydroxy-2-methylbenzenesulfonic acid;morpholine |
| SMILES | C1COCCN1.Cc1ccc(O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H8O4S.C4H9NO/c1-5-2-3-6(8)4-7(5)12(9,10)11;1-3-6-4-2-5-1/h2-4,8H,1H3,(H,9,10,11);5H,1-4H2 |
| InChIKey | YPCFDFCTMMIMCJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-methylbenzenesulfonic acid;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-methylbenzenesulfonic acid;morpholine?
The IUPAC name of 5-hydroxy-2-methylbenzenesulfonic acid;morpholine (CID 88713946) is 5-hydroxy-2-methylbenzenesulfonic acid;morpholine.
What is the SMILES notation for 5-hydroxy-2-methylbenzenesulfonic acid;morpholine?
The canonical SMILES for 5-hydroxy-2-methylbenzenesulfonic acid;morpholine is C1COCCN1.Cc1ccc(O)cc1S(=O)(=O)O.
What is the InChIKey of 5-hydroxy-2-methylbenzenesulfonic acid;morpholine?
The InChIKey is YPCFDFCTMMIMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4S.C4H9NO/c1-5-2-3-6(8)4-7(5)12(9,10)11;1-3-6-4-2-5-1/h2-4,8H,1H3,(H,9,10,11);5H,1-4H2.
What are the key properties of 5-hydroxy-2-methylbenzenesulfonic acid;morpholine?
5-hydroxy-2-methylbenzenesulfonic acid;morpholine has a molecular weight of 275.33 g/mol, XLogP of 0.55, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methylbenzenesulfonic acid;morpholine is sourced from PubChem (CID 88713946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).