C18H15ClN2OS — CID 8871503
2-(2-chloroprop-2-enylsulfanyl)-3-(4-methylphenyl)quinazolin-4-one (PubChem CID 8871503) has the molecular formula C18H15ClN2OS and a molecular weight of 342.85 g/mol. Its IUPAC name is 2-(2-chloroprop-2-enylsulfanyl)-3-(4-methylphenyl)quinazolin-4-one.
| Compound Name | 2-(2-chloroprop-2-enylsulfanyl)-3-(4-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 8871503 |
| Molecular Formula | C18H15ClN2OS |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(2-chloroprop-2-enylsulfanyl)-3-(4-methylphenyl)quinazolin-4-one |
| SMILES | C=C(Cl)CSc1nc2ccccc2c(=O)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C18H15ClN2OS/c1-12-7-9-14(10-8-12)21-17(22)15-5-3-4-6-16(15)20-18(21)23-11-13(2)19/h3-10H,2,11H2,1H3 |
| InChIKey | FLWGAPPXWIWHMD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |