About butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid
butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid (PubChem CID 88715043) has the molecular formula C14H22O6
and a molecular weight of 286.32 g/mol. Its IUPAC name is butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid.
Molecular Properties
| Compound Name | butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid |
| PubChem CID | 88715043 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid |
| SMILES | C=C(CC=CC(=O)O)C(=O)OC.CCCCOC(C)=O |
| InChI | InChI=1S/C8H10O4.C6H12O2/c1-6(8(11)12-2)4-3-5-7(9)10;1-3-4-5-8-6(2)7/h3,5H,1,4H2,2H3,(H,9,10);3-5H2,1-2H3 |
| InChIKey | NHXVFAMCAVQSHN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid?
The IUPAC name of butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid (CID 88715043) is butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid.
What is the SMILES notation for butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid?
The canonical SMILES for butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid is C=C(CC=CC(=O)O)C(=O)OC.CCCCOC(C)=O.
What is the InChIKey of butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid?
The InChIKey is NHXVFAMCAVQSHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C6H12O2/c1-6(8(11)12-2)4-3-5-7(9)10;1-3-4-5-8-6(2)7/h3,5H,1,4H2,2H3,(H,9,10);3-5H2,1-2H3.
What are the key properties of butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid?
butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid has a molecular weight of 286.32 g/mol, XLogP of 2.10, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl acetate;5-methoxycarbonylhexa-2,5-dienoic acid is sourced from PubChem (CID 88715043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).