About 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane
2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane (PubChem CID 88715352) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane |
| PubChem CID | 88715352 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane |
| SMILES | C1CO1.CC(CO)C(CO)(CO)CC1CO1 |
| InChI | InChI=1S/C9H18O4.C2H4O/c1-7(3-10)9(5-11,6-12)2-8-4-13-8;1-2-3-1/h7-8,10-12H,2-6H2,1H3;1-2H2 |
| InChIKey | FZODVYRTPDCYOE-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane?
The IUPAC name of 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane (CID 88715352) is 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane.
What is the SMILES notation for 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane?
The canonical SMILES for 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane is C1CO1.CC(CO)C(CO)(CO)CC1CO1.
What is the InChIKey of 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane?
The InChIKey is FZODVYRTPDCYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4.C2H4O/c1-7(3-10)9(5-11,6-12)2-8-4-13-8;1-2-3-1/h7-8,10-12H,2-6H2,1H3;1-2H2.
What are the key properties of 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane?
2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane has a molecular weight of 234.29 g/mol, XLogP of -0.61, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3-methyl-2-(oxiran-2-ylmethyl)butane-1,4-diol;oxirane is sourced from PubChem (CID 88715352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).