C22H29N3O4 — CID 88715792
(2R,3S,4S)-5-[4,5-dimethyl-2-[(4-prop-2-enylphenyl)diazenyl]anilino]pentane-1,2,3,4-tetrol (PubChem CID 88715792) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2R,3S,4S)-5-[4,5-dimethyl-2-[(4-prop-2-enylphenyl)diazenyl]anilino]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S)-5-[4,5-dimethyl-2-[(4-prop-2-enylphenyl)diazenyl]anilino]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 88715792 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (2R,3S,4S)-5-[4,5-dimethyl-2-[(4-prop-2-enylphenyl)diazenyl]anilino]pentane-1,2,3,4-tetrol |
| SMILES | C=CCc1ccc(/N=N/c2cc(C)c(C)cc2NC[C@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C22H29N3O4/c1-4-5-16-6-8-17(9-7-16)24-25-19-11-15(3)14(2)10-18(19)23-12-20(27)22(29)21(28)13-26/h4,6-11,20-23,26-29H,1,5,12-13H2,2-3H3/b25-24+/t20-,21+,22-/m0/s1 |
| InChIKey | XJADXCWFLKNGQM-CNQYQWAESA-N |
| XLogP | 2.93 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|