About 6-aminonona-7,8-dien-3-ol
6-aminonona-7,8-dien-3-ol (PubChem CID 88716045) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 6-aminonona-7,8-dien-3-ol.
Molecular Properties
| Compound Name | 6-aminonona-7,8-dien-3-ol |
| PubChem CID | 88716045 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 6-aminonona-7,8-dien-3-ol |
| SMILES | C=C=CC(N)CCC(O)CC |
| InChI | InChI=1S/C9H17NO/c1-3-5-8(10)6-7-9(11)4-2/h5,8-9,11H,1,4,6-7,10H2,2H3 |
| InChIKey | QIGXDYRFUOAEDC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-aminonona-7,8-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminonona-7,8-dien-3-ol?
The IUPAC name of 6-aminonona-7,8-dien-3-ol (CID 88716045) is 6-aminonona-7,8-dien-3-ol.
What is the SMILES notation for 6-aminonona-7,8-dien-3-ol?
The canonical SMILES for 6-aminonona-7,8-dien-3-ol is C=C=CC(N)CCC(O)CC.
What is the InChIKey of 6-aminonona-7,8-dien-3-ol?
The InChIKey is QIGXDYRFUOAEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-5-8(10)6-7-9(11)4-2/h5,8-9,11H,1,4,6-7,10H2,2H3.
What are the key properties of 6-aminonona-7,8-dien-3-ol?
6-aminonona-7,8-dien-3-ol has a molecular weight of 155.24 g/mol, XLogP of 1.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminonona-7,8-dien-3-ol is sourced from PubChem (CID 88716045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).