C22H36O9 — CID 88716262
ethoxyethane;2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene;oxaldehyde (PubChem CID 88716262) has the molecular formula C22H36O9 and a molecular weight of 444.52 g/mol. Its IUPAC name is ethoxyethane;2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene;oxaldehyde.
| Compound Name | ethoxyethane;2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene;oxaldehyde |
|---|---|
| PubChem CID | 88716262 |
| Molecular Formula | C22H36O9 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | ethoxyethane;2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene;oxaldehyde |
| SMILES | CCOCC.O=CC=O.c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C16H24O6.C4H10O.C2H2O2/c1-2-4-16-15(3-1)21-13-11-19-9-7-17-5-6-18-8-10-20-12-14-22-16;1-3-5-4-2;3-1-2-4/h1-4H,5-14H2;3-4H2,1-2H3;1-2H |
| InChIKey | FLJRDLAWFURTDC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|