C16H38N4O — CID 88716268
5-[3-amino-5-(dimethylamino)-4-methylpentoxy]-1-N,1-N,2-trimethylpentane-1,3-diamine (PubChem CID 88716268) has the molecular formula C16H38N4O and a molecular weight of 302.51 g/mol. Its IUPAC name is 5-[3-amino-5-(dimethylamino)-4-methylpentoxy]-1-N,1-N,2-trimethylpentane-1,3-diamine.
| Compound Name | 5-[3-amino-5-(dimethylamino)-4-methylpentoxy]-1-N,1-N,2-trimethylpentane-1,3-diamine |
|---|---|
| PubChem CID | 88716268 |
| Molecular Formula | C16H38N4O |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 5-[3-amino-5-(dimethylamino)-4-methylpentoxy]-1-N,1-N,2-trimethylpentane-1,3-diamine |
| SMILES | CC(CN(C)C)C(N)CCOCCC(N)C(C)CN(C)C |
| InChI | InChI=1S/C16H38N4O/c1-13(11-19(3)4)15(17)7-9-21-10-8-16(18)14(2)12-20(5)6/h13-16H,7-12,17-18H2,1-6H3 |
| InChIKey | NVLPNIORJDEWAT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|