C16H26O4 — CID 88717565
2-[(1S,2R,5R)-2-hydroxy-5-(3-hydroxy-4-pentoxybut-1-ynyl)cyclopentyl]acetaldehyde (PubChem CID 88717565) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(1S,2R,5R)-2-hydroxy-5-(3-hydroxy-4-pentoxybut-1-ynyl)cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,2R,5R)-2-hydroxy-5-(3-hydroxy-4-pentoxybut-1-ynyl)cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 88717565 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(1S,2R,5R)-2-hydroxy-5-(3-hydroxy-4-pentoxybut-1-ynyl)cyclopentyl]acetaldehyde |
| SMILES | CCCCCOCC(O)C#C[C@@H]1CC[C@@H](O)[C@H]1CC=O |
| InChI | InChI=1S/C16H26O4/c1-2-3-4-11-20-12-14(18)7-5-13-6-8-16(19)15(13)9-10-17/h10,13-16,18-19H,2-4,6,8-9,11-12H2,1H3/t13-,14?,15+,16-/m1/s1 |
| InChIKey | VYHCMIZDAGRKHQ-HEWHGDCOSA-N |
| XLogP | 1.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|