About 6-ethenylideneundecane-5,7-diol
6-ethenylideneundecane-5,7-diol (PubChem CID 88717945) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 6-ethenylideneundecane-5,7-diol.
Molecular Properties
| Compound Name | 6-ethenylideneundecane-5,7-diol |
| PubChem CID | 88717945 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 6-ethenylideneundecane-5,7-diol |
| SMILES | C=C=C(C(O)CCCC)C(O)CCCC |
| InChI | InChI=1S/C13H24O2/c1-4-7-9-12(14)11(6-3)13(15)10-8-5-2/h12-15H,3-5,7-10H2,1-2H3 |
| InChIKey | ADLLVOBOCNZUJJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethenylideneundecane-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenylideneundecane-5,7-diol?
The IUPAC name of 6-ethenylideneundecane-5,7-diol (CID 88717945) is 6-ethenylideneundecane-5,7-diol.
What is the SMILES notation for 6-ethenylideneundecane-5,7-diol?
The canonical SMILES for 6-ethenylideneundecane-5,7-diol is C=C=C(C(O)CCCC)C(O)CCCC.
What is the InChIKey of 6-ethenylideneundecane-5,7-diol?
The InChIKey is ADLLVOBOCNZUJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-7-9-12(14)11(6-3)13(15)10-8-5-2/h12-15H,3-5,7-10H2,1-2H3.
What are the key properties of 6-ethenylideneundecane-5,7-diol?
6-ethenylideneundecane-5,7-diol has a molecular weight of 212.33 g/mol, XLogP of 2.80, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenylideneundecane-5,7-diol is sourced from PubChem (CID 88717945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).