C16H19NO5 — CID 88718422
[(3R,4S)-6-acetyl-4-[formyl(methyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] formate (PubChem CID 88718422) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is [(3R,4S)-6-acetyl-4-[formyl(methyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] formate.
| Compound Name | [(3R,4S)-6-acetyl-4-[formyl(methyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] formate |
|---|---|
| PubChem CID | 88718422 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(3R,4S)-6-acetyl-4-[formyl(methyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] formate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](N(C)C=O)[C@@H](OC=O)C(C)(C)O2 |
| InChI | InChI=1S/C16H19NO5/c1-10(20)11-5-6-13-12(7-11)14(17(4)8-18)15(21-9-19)16(2,3)22-13/h5-9,14-15H,1-4H3/t14-,15+/m0/s1 |
| InChIKey | ULHVYKKXUVBSGJ-LSDHHAIUSA-N |
| XLogP | 1.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|