About (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one
(Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one (PubChem CID 88719787) has the molecular formula C12H14ClN3O
and a molecular weight of 251.72 g/mol. Its IUPAC name is (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one |
| PubChem CID | 88719787 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one |
| SMILES | C/C=C(/C)C(=O)N1CCc2nnc(Cl)cc2C1 |
| InChI | InChI=1S/C12H14ClN3O/c1-3-8(2)12(17)16-5-4-10-9(7-16)6-11(13)15-14-10/h3,6H,4-5,7H2,1-2H3/b8-3- |
| InChIKey | ILOXWFPVBLZOQG-BAQGIRSFSA-N |
| XLogP | 1.98 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one?
The IUPAC name of (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one (CID 88719787) is (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one.
What is the SMILES notation for (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one?
The canonical SMILES for (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one is C/C=C(/C)C(=O)N1CCc2nnc(Cl)cc2C1.
What is the InChIKey of (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one?
The InChIKey is ILOXWFPVBLZOQG-BAQGIRSFSA-N. The full InChI is InChI=1S/C12H14ClN3O/c1-3-8(2)12(17)16-5-4-10-9(7-16)6-11(13)15-14-10/h3,6H,4-5,7H2,1-2H3/b8-3-.
What are the key properties of (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one?
(Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one has a molecular weight of 251.72 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3-chloro-7,8-dihydro-5H-pyrido[4,3-c]pyridazin-6-yl)-2-methylbut-2-en-1-one is sourced from PubChem (CID 88719787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).