About 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium
2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium (PubChem CID 88720683) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium.
Molecular Properties
| Compound Name | 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium |
| PubChem CID | 88720683 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium |
| SMILES | CCC1=NC=CC[NH+]1[O-] |
| InChI | InChI=1S/C6H10N2O/c1-2-6-7-4-3-5-8(6)9/h3-4,8H,2,5H2,1H3 |
| InChIKey | CLKZSSIOYPYIRX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 39.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium?
The IUPAC name of 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium (CID 88720683) is 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium.
What is the SMILES notation for 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium?
The canonical SMILES for 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium is CCC1=NC=CC[NH+]1[O-].
What is the InChIKey of 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium?
The InChIKey is CLKZSSIOYPYIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-2-6-7-4-3-5-8(6)9/h3-4,8H,2,5H2,1H3.
What are the key properties of 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium?
2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium has a molecular weight of 126.16 g/mol, XLogP of -0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-oxido-1,6-dihydropyrimidin-1-ium is sourced from PubChem (CID 88720683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).