About benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate
benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 88721240) has the molecular formula C36H30NO3P
and a molecular weight of 555.61 g/mol. Its IUPAC name is benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate.
Molecular Properties
| Compound Name | benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate |
| PubChem CID | 88721240 |
| Molecular Formula | C36H30NO3P |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C(N1CCC1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H30NO3P/c38-33-26-27-37(33)35(36(39)40-34(28-16-6-1-7-17-28)29-18-8-2-9-19-29)41(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-25,34H,26-27H2 |
| InChIKey | JJIHNACIPPKOSZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate?
The IUPAC name of benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate (CID 88721240) is benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate.
What is the SMILES notation for benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate?
The canonical SMILES for benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate is O=C(OC(c1ccccc1)c1ccccc1)C(N1CCC1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate?
The InChIKey is JJIHNACIPPKOSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H30NO3P/c38-33-26-27-37(33)35(36(39)40-34(28-16-6-1-7-17-28)29-18-8-2-9-19-29)41(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-25,34H,26-27H2.
What are the key properties of benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate?
benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate has a molecular weight of 555.61 g/mol, XLogP of 5.68, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl 2-(2-oxoazetidin-1-yl)-2-(triphenyl-λ5-phosphanylidene)acetate is sourced from PubChem (CID 88721240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).