C20H22F4N2O2 — CID 88721898
1-cyclohexyl-2-pyrazin-2-yl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol (PubChem CID 88721898) has the molecular formula C20H22F4N2O2 and a molecular weight of 398.40 g/mol. Its IUPAC name is 1-cyclohexyl-2-pyrazin-2-yl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol.
| Compound Name | 1-cyclohexyl-2-pyrazin-2-yl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 88721898 |
| Molecular Formula | C20H22F4N2O2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-cyclohexyl-2-pyrazin-2-yl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol |
| SMILES | OC(Cc1cnccn1)(c1ccc(OC(F)(F)C(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H22F4N2O2/c21-18(22)20(23,24)28-17-8-6-15(7-9-17)19(27,14-4-2-1-3-5-14)12-16-13-25-10-11-26-16/h6-11,13-14,18,27H,1-5,12H2 |
| InChIKey | HQTVLOQSUKOGEL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|