C17H17NO5S — CID 88722162
4-(6,7,8,9-tetrahydro-5H-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl)benzenesulfonic acid (PubChem CID 88722162) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-(6,7,8,9-tetrahydro-5H-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl)benzenesulfonic acid.
| Compound Name | 4-(6,7,8,9-tetrahydro-5H-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88722162 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-(6,7,8,9-tetrahydro-5H-[1,3]dioxolo[4,5-h][3]benzazepin-5-yl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C2CNCCc3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C17H17NO5S/c19-24(20,21)13-3-1-11(2-4-13)15-9-18-6-5-12-7-16-17(8-14(12)15)23-10-22-16/h1-4,7-8,15,18H,5-6,9-10H2,(H,19,20,21) |
| InChIKey | RDOMFHYMCMKUGH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|