About 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione
4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione (PubChem CID 88722204) has the molecular formula C14H14OS
and a molecular weight of 230.33 g/mol. Its IUPAC name is 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione |
| PubChem CID | 88722204 |
| Molecular Formula | C14H14OS |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione |
| SMILES | OC(CC1=CCC(=S)C=C1)c1ccccc1 |
| InChI | InChI=1S/C14H14OS/c15-14(12-4-2-1-3-5-12)10-11-6-8-13(16)9-7-11/h1-8,14-15H,9-10H2 |
| InChIKey | UVMPTMWCNIWEKX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione?
The IUPAC name of 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione (CID 88722204) is 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione?
The canonical SMILES for 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione is OC(CC1=CCC(=S)C=C1)c1ccccc1.
What is the InChIKey of 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione?
The InChIKey is UVMPTMWCNIWEKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14OS/c15-14(12-4-2-1-3-5-12)10-11-6-8-13(16)9-7-11/h1-8,14-15H,9-10H2.
What are the key properties of 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione?
4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione has a molecular weight of 230.33 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxy-2-phenylethyl)cyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 88722204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).