About 8aH-thiochromen-4-amine
8aH-thiochromen-4-amine (PubChem CID 88722526) has the molecular formula C9H9NS
and a molecular weight of 163.25 g/mol. Its IUPAC name is 8aH-thiochromen-4-amine.
Molecular Properties
| Compound Name | 8aH-thiochromen-4-amine |
| PubChem CID | 88722526 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 8aH-thiochromen-4-amine |
| SMILES | NC1=C2C=CC=CC2SC=C1 |
| InChI | InChI=1S/C9H9NS/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6,9H,10H2 |
| InChIKey | SBRKRYPXUUUNEL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8aH-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8aH-thiochromen-4-amine?
The IUPAC name of 8aH-thiochromen-4-amine (CID 88722526) is 8aH-thiochromen-4-amine.
What is the SMILES notation for 8aH-thiochromen-4-amine?
The canonical SMILES for 8aH-thiochromen-4-amine is NC1=C2C=CC=CC2SC=C1.
What is the InChIKey of 8aH-thiochromen-4-amine?
The InChIKey is SBRKRYPXUUUNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6,9H,10H2.
What are the key properties of 8aH-thiochromen-4-amine?
8aH-thiochromen-4-amine has a molecular weight of 163.25 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8aH-thiochromen-4-amine is sourced from PubChem (CID 88722526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).