C15H10BrF2NO — CID 887227
1-(4-bromophenyl)-3-(3,4-difluoroanilino)prop-2-en-1-one (PubChem CID 887227) has the molecular formula C15H10BrF2NO and a molecular weight of 338.15 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(3,4-difluoroanilino)prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-(3,4-difluoroanilino)prop-2-en-1-one |
|---|---|
| PubChem CID | 887227 |
| Molecular Formula | C15H10BrF2NO |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-(4-bromophenyl)-3-(3,4-difluoroanilino)prop-2-en-1-one |
| SMILES | O=C(C=CNc1ccc(F)c(F)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H10BrF2NO/c16-11-3-1-10(2-4-11)15(20)7-8-19-12-5-6-13(17)14(18)9-12/h1-9,19H |
| InChIKey | QJAGMGHYXRMHDQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|