C21H23N2O+ — CID 88723527
3-methyl-4-aza-1-azoniapentacyclo[11.8.1.01,6.09,22.015,20]docosa-8,10,13(22),14,16,20-hexaen-7-one (PubChem CID 88723527) has the molecular formula C21H23N2O+ and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-methyl-4-aza-1-azoniapentacyclo[11.8.1.01,6.09,22.015,20]docosa-8,10,13(22),14,16,20-hexaen-7-one.
| Compound Name | 3-methyl-4-aza-1-azoniapentacyclo[11.8.1.01,6.09,22.015,20]docosa-8,10,13(22),14,16,20-hexaen-7-one |
|---|---|
| PubChem CID | 88723527 |
| Molecular Formula | C21H23N2O+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-methyl-4-aza-1-azoniapentacyclo[11.8.1.01,6.09,22.015,20]docosa-8,10,13(22),14,16,20-hexaen-7-one |
| SMILES | CC1C[N+]23C=C4CCC=CC4=CC4=C2C(=CC(=O)C3CN1)C=CC4 |
| InChI | InChI=1S/C21H23N2O/c1-14-12-23-13-18-6-3-2-5-15(18)9-16-7-4-8-17(21(16)23)10-20(24)19(23)11-22-14/h2,4-5,8-10,13-14,19,22H,3,6-7,11-12H2,1H3/q+1 |
| InChIKey | UNMXAABKHLMEQD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|