C31H43NO7 — CID 88723540
[(Z)-[9-[(2S,3R,6E)-3-acetyloxy-6-(2-acetyloxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-en-5-ylidene]amino] benzoate (PubChem CID 88723540) has the molecular formula C31H43NO7 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(Z)-[9-[(2S,3R,6E)-3-acetyloxy-6-(2-acetyloxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-en-5-ylidene]amino] benzoate.
| Compound Name | [(Z)-[9-[(2S,3R,6E)-3-acetyloxy-6-(2-acetyloxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-en-5-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 88723540 |
| Molecular Formula | C31H43NO7 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | [(Z)-[9-[(2S,3R,6E)-3-acetyloxy-6-(2-acetyloxyethylidene)-2-methyloxepan-2-yl]-2,6-dimethylnon-2-en-5-ylidene]amino] benzoate |
| SMILES | CC(=O)OC/C=C1\CC[C@@H](OC(C)=O)[C@](C)(CCCC(C)/C(CC=C(C)C)=N\OC(=O)c2ccccc2)OC1 |
| InChI | InChI=1S/C31H43NO7/c1-22(2)14-16-28(32-39-30(35)27-12-8-7-9-13-27)23(3)11-10-19-31(6)29(38-25(5)34)17-15-26(21-37-31)18-20-36-24(4)33/h7-9,12-14,18,23,29H,10-11,15-17,19-21H2,1-6H3/b26-18+,32-28-/t23?,29-,31+/m1/s1 |
| InChIKey | FCYJYCIEMZFOCU-ZBTORQIUSA-N |
| XLogP | 6.35 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|