C22H33ClO5 — CID 88723798
[9-[(2S,6E)-6-(2-chloro-2-oxoethylidene)-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate (PubChem CID 88723798) has the molecular formula C22H33ClO5 and a molecular weight of 412.95 g/mol. Its IUPAC name is [9-[(2S,6E)-6-(2-chloro-2-oxoethylidene)-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate.
| Compound Name | [9-[(2S,6E)-6-(2-chloro-2-oxoethylidene)-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate |
|---|---|
| PubChem CID | 88723798 |
| Molecular Formula | C22H33ClO5 |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [9-[(2S,6E)-6-(2-chloro-2-oxoethylidene)-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate |
| SMILES | CC(=O)OC(CC=C(C)C)C(C)CCC[C@]1(C)OC/C(=C/C(=O)Cl)CCC1=O |
| InChI | InChI=1S/C22H33ClO5/c1-15(2)8-10-19(28-17(4)24)16(3)7-6-12-22(5)20(25)11-9-18(14-27-22)13-21(23)26/h8,13,16,19H,6-7,9-12,14H2,1-5H3/b18-13+/t16?,19?,22-/m0/s1 |
| InChIKey | FSHMGMDAHHQTRE-XHMJOHCCSA-N |
| XLogP | 4.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|