About 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid
1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid (PubChem CID 88723925) has the molecular formula C19H33Cl2NO10P2
and a molecular weight of 568.32 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid |
| PubChem CID | 88723925 |
| Molecular Formula | C19H33Cl2NO10P2 |
| Molecular Weight | 568.32 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid |
| SMILES | COc1c(Cl)cc(Cl)cc1OCCC1CCCN1C1CCCCC1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C19H27Cl2NO2.2H3O4P/c1-23-19-17(21)12-14(20)13-18(19)24-11-9-16-8-5-10-22(16)15-6-3-2-4-7-15;2*1-5(2,3)4/h12-13,15-16H,2-11H2,1H3;2*(H3,1,2,3,4) |
| InChIKey | BHADLFNZVZBBGT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 177.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid?
The IUPAC name of 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid (CID 88723925) is 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid.
What is the SMILES notation for 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid?
The canonical SMILES for 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid is COc1c(Cl)cc(Cl)cc1OCCC1CCCN1C1CCCCC1.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid?
The InChIKey is BHADLFNZVZBBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27Cl2NO2.2H3O4P/c1-23-19-17(21)12-14(20)13-18(19)24-11-9-16-8-5-10-22(16)15-6-3-2-4-7-15;2*1-5(2,3)4/h12-13,15-16H,2-11H2,1H3;2*(H3,1,2,3,4).
What are the key properties of 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid?
1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid has a molecular weight of 568.32 g/mol, XLogP of 3.71, 6 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]pyrrolidine;phosphoric acid is sourced from PubChem (CID 88723925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).