C22H33N3O3 — CID 8872417
2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 8872417) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 8872417 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CN1CCN(Cc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H33N3O3/c1-6-22(7-2,8-3)23-21(26)17-25-13-11-24(12-14-25)16-18-9-10-19(27-4)20(15-18)28-5/h1,9-10,15H,7-8,11-14,16-17H2,2-5H3,(H,23,26) |
| InChIKey | USRAPAJHYRFUEP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|