C33H58O4SeSi2 — CID 88724884
4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(2-hydroxy-1-phenylselanylethyl)cyclopentan-1-one (PubChem CID 88724884) has the molecular formula C33H58O4SeSi2 and a molecular weight of 653.96 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(2-hydroxy-1-phenylselanylethyl)cyclopentan-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(2-hydroxy-1-phenylselanylethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 88724884 |
| Molecular Formula | C33H58O4SeSi2 |
| Molecular Weight | 653.96 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(2-hydroxy-1-phenylselanylethyl)cyclopentan-1-one |
| SMILES | CCCCC[C@@H](C=CC1C(O[Si](C)(C)C(C)(C)C)CC(=O)C1C(CO)[Se]c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H58O4SeSi2/c1-12-13-15-18-25(36-39(8,9)32(2,3)4)21-22-27-29(37-40(10,11)33(5,6)7)23-28(35)31(27)30(24-34)38-26-19-16-14-17-20-26/h14,16-17,19-22,25,27,29-31,34H,12-13,15,18,23-24H2,1-11H3/t25-,27?,29?,30?,31?/m0/s1 |
| InChIKey | NCSYODWLSQYFLI-XKIHBOOSSA-N |
| XLogP | 7.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.96 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|