C17H34F2O7Si2 — CID 88725732
(5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyethyl]-4,4-difluorodioxolan-3-one (PubChem CID 88725732) has the molecular formula C17H34F2O7Si2 and a molecular weight of 444.62 g/mol. Its IUPAC name is (5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyethyl]-4,4-difluorodioxolan-3-one.
| Compound Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyethyl]-4,4-difluorodioxolan-3-one |
|---|---|
| PubChem CID | 88725732 |
| Molecular Formula | C17H34F2O7Si2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyethyl]-4,4-difluorodioxolan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(O)[C@@H](O)[C@@]1(O[Si](C)(C)C(C)(C)C)OOC(=O)C1(F)F |
| InChI | InChI=1S/C17H34F2O7Si2/c1-14(2,3)27(7,8)24-12(21)11(20)17(16(18,19)13(22)23-25-17)26-28(9,10)15(4,5)6/h11-12,20-21H,1-10H3/t11-,12?,17+/m1/s1 |
| InChIKey | GONOWWBARNRSEH-AURTYUHDSA-N |
| XLogP | 3.53 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|