C18H30O5S3 — CID 88725846
S-[(3R,4S,5R,6S)-4,5-bis(acetylsulfanyl)-6-heptoxyoxan-3-yl] ethanethioate (PubChem CID 88725846) has the molecular formula C18H30O5S3 and a molecular weight of 422.63 g/mol. Its IUPAC name is S-[(3R,4S,5R,6S)-4,5-bis(acetylsulfanyl)-6-heptoxyoxan-3-yl] ethanethioate.
| Compound Name | S-[(3R,4S,5R,6S)-4,5-bis(acetylsulfanyl)-6-heptoxyoxan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 88725846 |
| Molecular Formula | C18H30O5S3 |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | S-[(3R,4S,5R,6S)-4,5-bis(acetylsulfanyl)-6-heptoxyoxan-3-yl] ethanethioate |
| SMILES | CCCCCCCO[C@H]1OC[C@@H](SC(C)=O)[C@H](SC(C)=O)[C@@H]1SC(C)=O |
| InChI | InChI=1S/C18H30O5S3/c1-5-6-7-8-9-10-22-18-17(26-14(4)21)16(25-13(3)20)15(11-23-18)24-12(2)19/h15-18H,5-11H2,1-4H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | FDZVANLQCJKDEU-OWSLCNJRSA-N |
| XLogP | 4.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|