About 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one
4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one (PubChem CID 88725948) has the molecular formula C17H15ClO6S
and a molecular weight of 382.82 g/mol. Its IUPAC name is 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one |
| PubChem CID | 88725948 |
| Molecular Formula | C17H15ClO6S |
| Molecular Weight | 382.82 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(O)ccc12.O=S(=O)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10O3.C6H5ClO3S/c1-2-7-5-11(13)14-10-6-8(12)3-4-9(7)10;7-5-1-3-6(4-2-5)11(8,9)10/h3-6,12H,2H2,1H3;1-4H,(H,8,9,10) |
| InChIKey | XQEDHMMTNSLWLV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one?
The IUPAC name of 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one (CID 88725948) is 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one.
What is the SMILES notation for 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one?
The canonical SMILES for 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one is CCc1cc(=O)oc2cc(O)ccc12.O=S(=O)(O)c1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one?
The InChIKey is XQEDHMMTNSLWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3.C6H5ClO3S/c1-2-7-5-11(13)14-10-6-8(12)3-4-9(7)10;7-5-1-3-6(4-2-5)11(8,9)10/h3-6,12H,2H2,1H3;1-4H,(H,8,9,10).
What are the key properties of 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one?
4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one has a molecular weight of 382.82 g/mol, XLogP of 3.65, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenesulfonic acid;4-ethyl-7-hydroxychromen-2-one is sourced from PubChem (CID 88725948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).