C15H24O5S3 — CID 88726163
S-[(3R,4S,5R,6R)-4,5-bis(acetylsulfanyl)-6-butan-2-yloxyoxan-3-yl] ethanethioate (PubChem CID 88726163) has the molecular formula C15H24O5S3 and a molecular weight of 380.55 g/mol. Its IUPAC name is S-[(3R,4S,5R,6R)-4,5-bis(acetylsulfanyl)-6-butan-2-yloxyoxan-3-yl] ethanethioate.
| Compound Name | S-[(3R,4S,5R,6R)-4,5-bis(acetylsulfanyl)-6-butan-2-yloxyoxan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 88726163 |
| Molecular Formula | C15H24O5S3 |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | S-[(3R,4S,5R,6R)-4,5-bis(acetylsulfanyl)-6-butan-2-yloxyoxan-3-yl] ethanethioate |
| SMILES | CCC(C)O[C@H]1OC[C@@H](SC(C)=O)[C@H](SC(C)=O)[C@@H]1SC(C)=O |
| InChI | InChI=1S/C15H24O5S3/c1-6-8(2)20-15-14(23-11(5)18)13(22-10(4)17)12(7-19-15)21-9(3)16/h8,12-15H,6-7H2,1-5H3/t8?,12-,13+,14+,15-/m1/s1 |
| InChIKey | REFNJMPDURONJR-PQQMINTMSA-N |
| XLogP | 3.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|