About 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid
2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid (PubChem CID 88726235) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid.
Molecular Properties
| Compound Name | 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid |
| PubChem CID | 88726235 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid |
| SMILES | C/C=C/C=C/C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O4/c1-2-3-4-5-6(7(9)10)8(11)12/h2-6H,1H3,(H,9,10)(H,11,12)/b3-2+,5-4+ |
| InChIKey | QSGWVSHKHNSHIB-MQQKCMAXSA-N |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid?
The IUPAC name of 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid (CID 88726235) is 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid.
What is the SMILES notation for 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid?
The canonical SMILES for 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid is C/C=C/C=C/C(C(=O)O)C(=O)O.
What is the InChIKey of 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid?
The InChIKey is QSGWVSHKHNSHIB-MQQKCMAXSA-N. The full InChI is InChI=1S/C8H10O4/c1-2-3-4-5-6(7(9)10)8(11)12/h2-6H,1H3,(H,9,10)(H,11,12)/b3-2+,5-4+.
What are the key properties of 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid?
2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid has a molecular weight of 170.16 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,3E)-penta-1,3-dienyl]propanedioic acid is sourced from PubChem (CID 88726235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).