About (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate
(2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate (PubChem CID 88726504) has the molecular formula C16H22N2O4S
and a molecular weight of 338.43 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate |
| PubChem CID | 88726504 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate |
| SMILES | CN(SN1CCCCC1)C(=O)Oc1cccc2c1OC(C)(C)O2 |
| InChI | InChI=1S/C16H22N2O4S/c1-16(2)21-13-9-7-8-12(14(13)22-16)20-15(19)17(3)23-18-10-5-4-6-11-18/h7-9H,4-6,10-11H2,1-3H3 |
| InChIKey | FXNUKDXUMDAEBC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate?
The IUPAC name of (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate (CID 88726504) is (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate.
What is the SMILES notation for (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate?
The canonical SMILES for (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate is CN(SN1CCCCC1)C(=O)Oc1cccc2c1OC(C)(C)O2.
What is the InChIKey of (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate?
The InChIKey is FXNUKDXUMDAEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4S/c1-16(2)21-13-9-7-8-12(14(13)22-16)20-15(19)17(3)23-18-10-5-4-6-11-18/h7-9H,4-6,10-11H2,1-3H3.
What are the key properties of (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate?
(2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate has a molecular weight of 338.43 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-piperidin-1-ylsulfanylcarbamate is sourced from PubChem (CID 88726504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).