C54H99O3P — CID 88726747
tris[(9Z,12Z)-octadeca-9,12-dienyl] phosphite (PubChem CID 88726747) has the molecular formula C54H99O3P and a molecular weight of 827.36 g/mol. Its IUPAC name is tris[(9Z,12Z)-octadeca-9,12-dienyl] phosphite.
| Compound Name | tris[(9Z,12Z)-octadeca-9,12-dienyl] phosphite |
|---|---|
| PubChem CID | 88726747 |
| Molecular Formula | C54H99O3P |
| Molecular Weight | 827.36 g/mol |
| Exact Mass | 826.73 |
| IUPAC Name | tris[(9Z,12Z)-octadeca-9,12-dienyl] phosphite |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOP(OCCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C54H99O3P/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-58(56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h16-21,25-30H,4-15,22-24,31-54H2,1-3H3/b19-16-,20-17-,21-18-,28-25-,29-26-,30-27- |
| InChIKey | VDKBJYSHWCQUJS-BBWANDEASA-N |
| XLogP | 19.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.36 |
| LogP ≤ 5 | 19.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|