About 1,4-dioxane;pyrene
1,4-dioxane;pyrene (PubChem CID 88726841) has the molecular formula C20H18O2
and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,4-dioxane;pyrene.
Molecular Properties
| Compound Name | 1,4-dioxane;pyrene |
| PubChem CID | 88726841 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1,4-dioxane;pyrene |
| SMILES | C1COCCO1.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C4H8O2/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-2-6-4-3-5-1/h1-10H;1-4H2 |
| InChIKey | XFUXBFWTCIIJIM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxane;pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;pyrene?
The IUPAC name of 1,4-dioxane;pyrene (CID 88726841) is 1,4-dioxane;pyrene.
What is the SMILES notation for 1,4-dioxane;pyrene?
The canonical SMILES for 1,4-dioxane;pyrene is C1COCCO1.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 1,4-dioxane;pyrene?
The InChIKey is XFUXBFWTCIIJIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C4H8O2/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-2-6-4-3-5-1/h1-10H;1-4H2.
What are the key properties of 1,4-dioxane;pyrene?
1,4-dioxane;pyrene has a molecular weight of 290.36 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;pyrene is sourced from PubChem (CID 88726841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).