About (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile
(2Z)-2-ethylsulfonylpenta-2,4-dienenitrile (PubChem CID 88726989) has the molecular formula C7H9NO2S
and a molecular weight of 171.22 g/mol. Its IUPAC name is (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile |
| PubChem CID | 88726989 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile |
| SMILES | C=C/C=C(/C#N)S(=O)(=O)CC |
| InChI | InChI=1S/C7H9NO2S/c1-3-5-7(6-8)11(9,10)4-2/h3,5H,1,4H2,2H3/b7-5- |
| InChIKey | CMSPDGPPYLDIRQ-ALCCZGGFSA-N |
| XLogP | 1.01 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile?
The IUPAC name of (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile (CID 88726989) is (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile.
What is the SMILES notation for (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile?
The canonical SMILES for (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile is C=C/C=C(/C#N)S(=O)(=O)CC.
What is the InChIKey of (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile?
The InChIKey is CMSPDGPPYLDIRQ-ALCCZGGFSA-N. The full InChI is InChI=1S/C7H9NO2S/c1-3-5-7(6-8)11(9,10)4-2/h3,5H,1,4H2,2H3/b7-5-.
What are the key properties of (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile?
(2Z)-2-ethylsulfonylpenta-2,4-dienenitrile has a molecular weight of 171.22 g/mol, XLogP of 1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylsulfonylpenta-2,4-dienenitrile is sourced from PubChem (CID 88726989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).