About acetamido acetate;1,1'-biphenyl
acetamido acetate;1,1'-biphenyl (PubChem CID 88727809) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is acetamido acetate;1,1'-biphenyl.
Molecular Properties
| Compound Name | acetamido acetate;1,1'-biphenyl |
| PubChem CID | 88727809 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | acetamido acetate;1,1'-biphenyl |
| SMILES | CC(=O)NOC(C)=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H7NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3(6)5-8-4(2)7/h1-10H;1-2H3,(H,5,6) |
| InChIKey | JLJYVWRTGIFENG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetamido acetate;1,1'-biphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamido acetate;1,1'-biphenyl?
The IUPAC name of acetamido acetate;1,1'-biphenyl (CID 88727809) is acetamido acetate;1,1'-biphenyl.
What is the SMILES notation for acetamido acetate;1,1'-biphenyl?
The canonical SMILES for acetamido acetate;1,1'-biphenyl is CC(=O)NOC(C)=O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of acetamido acetate;1,1'-biphenyl?
The InChIKey is JLJYVWRTGIFENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C4H7NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3(6)5-8-4(2)7/h1-10H;1-2H3,(H,5,6).
What are the key properties of acetamido acetate;1,1'-biphenyl?
acetamido acetate;1,1'-biphenyl has a molecular weight of 271.32 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamido acetate;1,1'-biphenyl is sourced from PubChem (CID 88727809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).