C13H32N4O4 — CID 88727897
2,6-diamino-4-(2-aminoethyl)-4-[amino(hydroxy)methyl]-2-ethyl-6-methylheptane-1,3,5-triol (PubChem CID 88727897) has the molecular formula C13H32N4O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2,6-diamino-4-(2-aminoethyl)-4-[amino(hydroxy)methyl]-2-ethyl-6-methylheptane-1,3,5-triol.
| Compound Name | 2,6-diamino-4-(2-aminoethyl)-4-[amino(hydroxy)methyl]-2-ethyl-6-methylheptane-1,3,5-triol |
|---|---|
| PubChem CID | 88727897 |
| Molecular Formula | C13H32N4O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2,6-diamino-4-(2-aminoethyl)-4-[amino(hydroxy)methyl]-2-ethyl-6-methylheptane-1,3,5-triol |
| SMILES | CCC(N)(CO)C(O)C(CCN)(C(N)O)C(O)C(C)(C)N |
| InChI | InChI=1S/C13H32N4O4/c1-4-12(17,7-18)9(20)13(5-6-14,10(15)21)8(19)11(2,3)16/h8-10,18-21H,4-7,14-17H2,1-3H3 |
| InChIKey | AMKWXEIBWCINBS-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|