C16H22O12 — CID 88728484
butanedioic acid;(6Z)-2,3-dihydro-1,4-dioxocine-5,8-dione;hexanedioic acid (PubChem CID 88728484) has the molecular formula C16H22O12 and a molecular weight of 406.34 g/mol. Its IUPAC name is butanedioic acid;(6Z)-2,3-dihydro-1,4-dioxocine-5,8-dione;hexanedioic acid.
| Compound Name | butanedioic acid;(6Z)-2,3-dihydro-1,4-dioxocine-5,8-dione;hexanedioic acid |
|---|---|
| PubChem CID | 88728484 |
| Molecular Formula | C16H22O12 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | butanedioic acid;(6Z)-2,3-dihydro-1,4-dioxocine-5,8-dione;hexanedioic acid |
| SMILES | O=C(O)CCC(=O)O.O=C(O)CCCCC(=O)O.O=C1/C=C\C(=O)OCCO1 |
| InChI | InChI=1S/C6H6O4.C6H10O4.C4H6O4/c7-5-1-2-6(8)10-4-3-9-5;7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8/h1-2H,3-4H2;1-4H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8)/b2-1-;; |
| InChIKey | MRYXJLQMPKXJPA-UAIGNFCESA-N |
| XLogP | 0.29 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|