About (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane
(2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88728802) has the molecular formula C14H25N2O4PS2
and a molecular weight of 380.47 g/mol. Its IUPAC name is (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 88728802 |
| Molecular Formula | C14H25N2O4PS2 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCOc1cc(CO[P@](=S)(OCC)SC(C)C)nc(OCC)n1 |
| InChI | InChI=1S/C14H25N2O4PS2/c1-6-17-13-9-12(15-14(16-13)18-7-2)10-20-21(22,19-8-3)23-11(4)5/h9,11H,6-8,10H2,1-5H3/t21-/m0/s1 |
| InChIKey | IJXIAPJFXSWGPV-NRFANRHFSA-N |
| XLogP | 4.19 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane?
The IUPAC name of (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane (CID 88728802) is (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane is CCOc1cc(CO[P@](=S)(OCC)SC(C)C)nc(OCC)n1.
What is the InChIKey of (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane?
The InChIKey is IJXIAPJFXSWGPV-NRFANRHFSA-N. The full InChI is InChI=1S/C14H25N2O4PS2/c1-6-17-13-9-12(15-14(16-13)18-7-2)10-20-21(22,19-8-3)23-11(4)5/h9,11H,6-8,10H2,1-5H3/t21-/m0/s1.
What are the key properties of (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane?
(2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane has a molecular weight of 380.47 g/mol, XLogP of 4.19, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-diethoxypyrimidin-4-yl)methoxy-ethoxy-propan-2-ylsulfanyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 88728802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).