C27H36O8 — CID 88728867
[2-[(8S,9S,10R,13S,14S,17R)-17-(ethoxymethoxy)-11-formyloxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 88728867) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-17-(ethoxymethoxy)-11-formyloxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-17-(ethoxymethoxy)-11-formyloxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 88728867 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-17-(ethoxymethoxy)-11-formyloxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CCOCO[C@]1(C(=O)COC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(OC=O)C[C@@]21C |
| InChI | InChI=1S/C27H36O8/c1-5-32-16-35-27(23(31)14-33-17(2)29)11-9-21-20-7-6-18-12-19(30)8-10-25(18,3)24(20)22(34-15-28)13-26(21,27)4/h8,10,12,15,20-22,24H,5-7,9,11,13-14,16H2,1-4H3/t20-,21-,22?,24+,25-,26-,27-/m0/s1 |
| InChIKey | UKUJHWRVMKKRIT-GPIXWBHVSA-N |
| XLogP | 3.33 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|