About dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate
dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate (PubChem CID 88729158) has the molecular formula C31H51NO3
and a molecular weight of 485.75 g/mol. Its IUPAC name is dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate.
Molecular Properties
| Compound Name | dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate |
| PubChem CID | 88729158 |
| Molecular Formula | C31H51NO3 |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.39 |
| IUPAC Name | dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate |
| SMILES | CCCCCCCC=CCOC(=O)C(CCCCCCCCCc1cccc(CC(C)C)c1)=NO |
| InChI | InChI=1S/C31H51NO3/c1-4-5-6-7-8-12-15-18-24-35-31(33)30(32-34)23-17-14-11-9-10-13-16-20-28-21-19-22-29(26-28)25-27(2)3/h15,18-19,21-22,26-27,34H,4-14,16-17,20,23-25H2,1-3H3 |
| InChIKey | ZONHYGIYHDIRMO-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate?
The IUPAC name of dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate (CID 88729158) is dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate.
What is the SMILES notation for dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate?
The canonical SMILES for dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate is CCCCCCCC=CCOC(=O)C(CCCCCCCCCc1cccc(CC(C)C)c1)=NO.
What is the InChIKey of dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate?
The InChIKey is ZONHYGIYHDIRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H51NO3/c1-4-5-6-7-8-12-15-18-24-35-31(33)30(32-34)23-17-14-11-9-10-13-16-20-28-21-19-22-29(26-28)25-27(2)3/h15,18-19,21-22,26-27,34H,4-14,16-17,20,23-25H2,1-3H3.
What are the key properties of dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate?
dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate has a molecular weight of 485.75 g/mol, XLogP of 8.84, 21 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dec-2-enyl 2-hydroxyimino-11-[3-(2-methylpropyl)phenyl]undecanoate is sourced from PubChem (CID 88729158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).