C13H7Br7O4 — CID 88729269
4-O-(1,1-dibromopropyl) 1-O-(2,3,4,5,6-pentabromophenyl) (E)-but-2-enedioate (PubChem CID 88729269) has the molecular formula C13H7Br7O4 and a molecular weight of 786.52 g/mol. Its IUPAC name is 4-O-(1,1-dibromopropyl) 1-O-(2,3,4,5,6-pentabromophenyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(1,1-dibromopropyl) 1-O-(2,3,4,5,6-pentabromophenyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88729269 |
| Molecular Formula | C13H7Br7O4 |
| Molecular Weight | 786.52 g/mol |
| Exact Mass | 779.46 |
| IUPAC Name | 4-O-(1,1-dibromopropyl) 1-O-(2,3,4,5,6-pentabromophenyl) (E)-but-2-enedioate |
| SMILES | CCC(Br)(Br)OC(=O)/C=C/C(=O)Oc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C13H7Br7O4/c1-2-13(19,20)24-6(22)4-3-5(21)23-12-10(17)8(15)7(14)9(16)11(12)18/h3-4H,2H2,1H3/b4-3+ |
| InChIKey | PWGASJNDZAINPK-ONEGZZNKSA-N |
| XLogP | 7.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.52 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|