About [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate
[3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate (PubChem CID 88729508) has the molecular formula C20H26O7
and a molecular weight of 378.42 g/mol. Its IUPAC name is [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate.
Molecular Properties
| Compound Name | [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate |
| PubChem CID | 88729508 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate |
| SMILES | C=CC(OC(C=C)C(C=C)(OC(C)=O)C(C)=O)C(C=C)(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C20H26O7/c1-9-17(19(11-3,13(5)21)26-15(7)23)25-18(10-2)20(12-4,14(6)22)27-16(8)24/h9-12,17-18H,1-4H2,5-8H3 |
| InChIKey | ZBHGVQKKSHCPQY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate?
The IUPAC name of [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate (CID 88729508) is [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate.
What is the SMILES notation for [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate?
The canonical SMILES for [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate is C=CC(OC(C=C)C(C=C)(OC(C)=O)C(C)=O)C(C=C)(OC(C)=O)C(C)=O.
What is the InChIKey of [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate?
The InChIKey is ZBHGVQKKSHCPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O7/c1-9-17(19(11-3,13(5)21)26-15(7)23)25-18(10-2)20(12-4,14(6)22)27-16(8)24/h9-12,17-18H,1-4H2,5-8H3.
What are the key properties of [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate?
[3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate has a molecular weight of 378.42 g/mol, XLogP of 2.27, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyl-4-(4-acetyl-4-acetyloxyhexa-1,5-dien-3-yl)oxyhexa-1,5-dien-3-yl] acetate is sourced from PubChem (CID 88729508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).