C12H18ClF5N2O — CID 88730005
1-(1-chloroethyl)-3-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)urea (PubChem CID 88730005) has the molecular formula C12H18ClF5N2O and a molecular weight of 336.73 g/mol. Its IUPAC name is 1-(1-chloroethyl)-3-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)urea.
| Compound Name | 1-(1-chloroethyl)-3-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)urea |
|---|---|
| PubChem CID | 88730005 |
| Molecular Formula | C12H18ClF5N2O |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-(1-chloroethyl)-3-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)urea |
| SMILES | CC(Cl)NC(=O)NC(C1CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18ClF5N2O/c1-7(13)19-10(21)20-9(8-5-3-2-4-6-8)11(14,15)12(16,17)18/h7-9H,2-6H2,1H3,(H2,19,20,21) |
| InChIKey | NXLPULZQMJTUPX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|