About pyrido[2,1-a][2,3,4]benzotriazepine
pyrido[2,1-a][2,3,4]benzotriazepine (PubChem CID 88730694) has the molecular formula C12H9N3
and a molecular weight of 195.22 g/mol. Its IUPAC name is pyrido[2,1-a][2,3,4]benzotriazepine.
Molecular Properties
| Compound Name | pyrido[2,1-a][2,3,4]benzotriazepine |
| PubChem CID | 88730694 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | pyrido[2,1-a][2,3,4]benzotriazepine |
| SMILES | C1=CC2=c3ccccc3=CN=NN2C=C1 |
| InChI | InChI=1S/C12H9N3/c1-2-6-11-10(5-1)9-13-14-15-8-4-3-7-12(11)15/h1-9H |
| InChIKey | WLWHXNQSWYBCQE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrido[2,1-a][2,3,4]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,1-a][2,3,4]benzotriazepine?
The IUPAC name of pyrido[2,1-a][2,3,4]benzotriazepine (CID 88730694) is pyrido[2,1-a][2,3,4]benzotriazepine.
What is the SMILES notation for pyrido[2,1-a][2,3,4]benzotriazepine?
The canonical SMILES for pyrido[2,1-a][2,3,4]benzotriazepine is C1=CC2=c3ccccc3=CN=NN2C=C1.
What is the InChIKey of pyrido[2,1-a][2,3,4]benzotriazepine?
The InChIKey is WLWHXNQSWYBCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3/c1-2-6-11-10(5-1)9-13-14-15-8-4-3-7-12(11)15/h1-9H.
What are the key properties of pyrido[2,1-a][2,3,4]benzotriazepine?
pyrido[2,1-a][2,3,4]benzotriazepine has a molecular weight of 195.22 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,1-a][2,3,4]benzotriazepine is sourced from PubChem (CID 88730694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).