About 2-nitroprop-2-enyl nitrite
2-nitroprop-2-enyl nitrite (PubChem CID 88730819) has the molecular formula C3H4N2O4
and a molecular weight of 132.07 g/mol. Its IUPAC name is 2-nitroprop-2-enyl nitrite.
Molecular Properties
| Compound Name | 2-nitroprop-2-enyl nitrite |
| PubChem CID | 88730819 |
| Molecular Formula | C3H4N2O4 |
| Molecular Weight | 132.07 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 2-nitroprop-2-enyl nitrite |
| SMILES | C=C(CON=O)[N+](=O)[O-] |
| InChI | InChI=1S/C3H4N2O4/c1-3(5(7)8)2-9-4-6/h1-2H2 |
| InChIKey | RECOVSMNTSYIGV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.07 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroprop-2-enyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroprop-2-enyl nitrite?
The IUPAC name of 2-nitroprop-2-enyl nitrite (CID 88730819) is 2-nitroprop-2-enyl nitrite.
What is the SMILES notation for 2-nitroprop-2-enyl nitrite?
The canonical SMILES for 2-nitroprop-2-enyl nitrite is C=C(CON=O)[N+](=O)[O-].
What is the InChIKey of 2-nitroprop-2-enyl nitrite?
The InChIKey is RECOVSMNTSYIGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O4/c1-3(5(7)8)2-9-4-6/h1-2H2.
What are the key properties of 2-nitroprop-2-enyl nitrite?
2-nitroprop-2-enyl nitrite has a molecular weight of 132.07 g/mol, XLogP of 0.47, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroprop-2-enyl nitrite is sourced from PubChem (CID 88730819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).