C14H17NO3 — CID 88730831
[2-(2,6-dimethylanilino)acetyl] (E)-but-2-enoate (PubChem CID 88730831) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)acetyl] (E)-but-2-enoate.
| Compound Name | [2-(2,6-dimethylanilino)acetyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 88730831 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [2-(2,6-dimethylanilino)acetyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC(=O)CNc1c(C)cccc1C |
| InChI | InChI=1S/C14H17NO3/c1-4-6-12(16)18-13(17)9-15-14-10(2)7-5-8-11(14)3/h4-8,15H,9H2,1-3H3/b6-4+ |
| InChIKey | VFVKKOSPJQTWRM-GQCTYLIASA-N |
| XLogP | 2.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|