About potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane
potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88730962) has the molecular formula C6H14KO2PS2
and a molecular weight of 252.38 g/mol. Its IUPAC name is potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 88730962 |
| Molecular Formula | C6H14KO2PS2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCOP([O-])(=S)SCCC.[K+] |
| InChI | InChI=1S/C6H15O2PS2.K/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1 |
| InChIKey | OHLDJVCAAITTBV-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The IUPAC name of potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (CID 88730962) is potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane is CCCOP([O-])(=S)SCCC.[K+].
What is the InChIKey of potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
The InChIKey is OHLDJVCAAITTBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15O2PS2.K/c1-3-5-8-9(7,10)11-6-4-2;/h3-6H2,1-2H3,(H,7,10);/q;+1/p-1.
What are the key properties of potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane?
potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane has a molecular weight of 252.38 g/mol, XLogP of -0.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium oxido-propoxy-propylsulfanyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 88730962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).