About benzenesulfonic acid;1,1-diphenylhydrazine
benzenesulfonic acid;1,1-diphenylhydrazine (PubChem CID 88730988) has the molecular formula C18H18N2O3S
and a molecular weight of 342.42 g/mol. Its IUPAC name is benzenesulfonic acid;1,1-diphenylhydrazine.
Molecular Properties
| Compound Name | benzenesulfonic acid;1,1-diphenylhydrazine |
| PubChem CID | 88730988 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | benzenesulfonic acid;1,1-diphenylhydrazine |
| SMILES | NN(c1ccccc1)c1ccccc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C12H12N2.C6H6O3S/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-10(8,9)6-4-2-1-3-5-6/h1-10H,13H2;1-5H,(H,7,8,9) |
| InChIKey | YJRBEFFFQRGEMV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;1,1-diphenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;1,1-diphenylhydrazine?
The IUPAC name of benzenesulfonic acid;1,1-diphenylhydrazine (CID 88730988) is benzenesulfonic acid;1,1-diphenylhydrazine.
What is the SMILES notation for benzenesulfonic acid;1,1-diphenylhydrazine?
The canonical SMILES for benzenesulfonic acid;1,1-diphenylhydrazine is NN(c1ccccc1)c1ccccc1.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;1,1-diphenylhydrazine?
The InChIKey is YJRBEFFFQRGEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C6H6O3S/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-10(8,9)6-4-2-1-3-5-6/h1-10H,13H2;1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid;1,1-diphenylhydrazine?
benzenesulfonic acid;1,1-diphenylhydrazine has a molecular weight of 342.42 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;1,1-diphenylhydrazine is sourced from PubChem (CID 88730988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).